C27H16Cl2F9N3O3 — CID 175350951
3-[3,5-bis(trifluoromethyl)benzoyl]-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzohydrazide (PubChem CID 175350951) has the molecular formula C27H16Cl2F9N3O3 and a molecular weight of 672.33 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)benzoyl]-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzohydrazide.
| Compound Name | 3-[3,5-bis(trifluoromethyl)benzoyl]-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 175350951 |
| Molecular Formula | C27H16Cl2F9N3O3 |
| Molecular Weight | 672.33 g/mol |
| Exact Mass | 671.04 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)benzoyl]-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzohydrazide |
| SMILES | Cc1c(C(=O)NN)ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)c1C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H16Cl2F9N3O3/c1-11-18(23(43)40-39)2-3-19(20-10-24(44-41-20,27(36,37)38)13-7-16(28)9-17(29)8-13)21(11)22(42)12-4-14(25(30,31)32)6-15(5-12)26(33,34)35/h2-9H,10,39H2,1H3,(H,40,43) |
| InChIKey | ZQJZHJIAKKONDP-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.33 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|