C18H11Cl2F3INO3 — CID 151846670
3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-iodo-6-methylbenzoic acid (PubChem CID 151846670) has the molecular formula C18H11Cl2F3INO3 and a molecular weight of 544.09 g/mol. Its IUPAC name is 3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-iodo-6-methylbenzoic acid.
| Compound Name | 3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-iodo-6-methylbenzoic acid |
|---|---|
| PubChem CID | 151846670 |
| Molecular Formula | C18H11Cl2F3INO3 |
| Molecular Weight | 544.09 g/mol |
| Exact Mass | 542.91 |
| IUPAC Name | 3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-iodo-6-methylbenzoic acid |
| SMILES | Cc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)c(I)c1C(=O)O |
| InChI | InChI=1S/C18H11Cl2F3INO3/c1-8-2-3-12(15(24)14(8)16(26)27)13-7-17(28-25-13,18(21,22)23)9-4-10(19)6-11(20)5-9/h2-6H,7H2,1H3,(H,26,27) |
| InChIKey | SHUJNJHGHPQEAX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.09 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|