C24H17Cl2F3N2O4 — CID 172679642
[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenoxy]-phenylcarbamic acid (PubChem CID 172679642) has the molecular formula C24H17Cl2F3N2O4 and a molecular weight of 525.31 g/mol. Its IUPAC name is [5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenoxy]-phenylcarbamic acid.
| Compound Name | [5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenoxy]-phenylcarbamic acid |
|---|---|
| PubChem CID | 172679642 |
| Molecular Formula | C24H17Cl2F3N2O4 |
| Molecular Weight | 525.31 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | [5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenoxy]-phenylcarbamic acid |
| SMILES | Cc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1ON(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C24H17Cl2F3N2O4/c1-14-7-8-15(9-21(14)34-31(22(32)33)19-5-3-2-4-6-19)20-13-23(35-30-20,24(27,28)29)16-10-17(25)12-18(26)11-16/h2-12H,13H2,1H3,(H,32,33) |
| InChIKey | AFIHCLWQPZMVJG-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.31 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|