C28H23Cl2F4N3O3 — CID 140578772
2-[2-(cyclobutylmethoxyimino)ethyl]-4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide (PubChem CID 140578772) has the molecular formula C28H23Cl2F4N3O3 and a molecular weight of 596.41 g/mol. Its IUPAC name is 2-[2-(cyclobutylmethoxyimino)ethyl]-4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide.
| Compound Name | 2-[2-(cyclobutylmethoxyimino)ethyl]-4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 140578772 |
| Molecular Formula | C28H23Cl2F4N3O3 |
| Molecular Weight | 596.41 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | 2-[2-(cyclobutylmethoxyimino)ethyl]-4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide |
| SMILES | NC(=O)c1c(CC=NOCC2CCC2)cc(C2=NOC(c3cc(Cl)c(F)c(Cl)c3)(C(F)(F)F)C2)c2ccccc12 |
| InChI | InChI=1S/C28H23Cl2F4N3O3/c29-21-11-17(12-22(30)25(21)31)27(28(32,33)34)13-23(37-40-27)20-10-16(8-9-36-39-14-15-4-3-5-15)24(26(35)38)19-7-2-1-6-18(19)20/h1-2,6-7,9-12,15H,3-5,8,13-14H2,(H2,35,38) |
| InChIKey | SLUSCFJBMUIIRQ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.41 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|