C25H19Cl3F3N3O3 — CID 140578799
2-(2-ethoxyiminoethyl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide (PubChem CID 140578799) has the molecular formula C25H19Cl3F3N3O3 and a molecular weight of 572.80 g/mol. Its IUPAC name is 2-(2-ethoxyiminoethyl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide.
| Compound Name | 2-(2-ethoxyiminoethyl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 140578799 |
| Molecular Formula | C25H19Cl3F3N3O3 |
| Molecular Weight | 572.80 g/mol |
| Exact Mass | 571.04 |
| IUPAC Name | 2-(2-ethoxyiminoethyl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide |
| SMILES | CCON=CCc1cc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)c2ccccc2c1C(N)=O |
| InChI | InChI=1S/C25H19Cl3F3N3O3/c1-2-36-33-8-7-13-9-17(15-5-3-4-6-16(15)21(13)23(32)35)20-12-24(37-34-20,25(29,30)31)14-10-18(26)22(28)19(27)11-14/h3-6,8-11H,2,7,12H2,1H3,(H2,32,35) |
| InChIKey | BDNDFMMYIXUGLJ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.80 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|