C26H18Cl2F7N3O3 — CID 87169621
4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[(2Z)-2-ethoxyimino-3,3,3-trifluoropropyl]naphthalene-1-carboxamide (PubChem CID 87169621) has the molecular formula C26H18Cl2F7N3O3 and a molecular weight of 624.34 g/mol. Its IUPAC name is 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[(2Z)-2-ethoxyimino-3,3,3-trifluoropropyl]naphthalene-1-carboxamide.
| Compound Name | 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[(2Z)-2-ethoxyimino-3,3,3-trifluoropropyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 87169621 |
| Molecular Formula | C26H18Cl2F7N3O3 |
| Molecular Weight | 624.34 g/mol |
| Exact Mass | 623.06 |
| IUPAC Name | 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[(2Z)-2-ethoxyimino-3,3,3-trifluoropropyl]naphthalene-1-carboxamide |
| SMILES | CCO/N=C(/CNC(=O)c1ccc(C2=NOC(c3cc(Cl)c(F)c(Cl)c3)(C(F)(F)F)C2)c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C26H18Cl2F7N3O3/c1-2-40-38-21(25(30,31)32)12-36-23(39)17-8-7-16(14-5-3-4-6-15(14)17)20-11-24(41-37-20,26(33,34)35)13-9-18(27)22(29)19(28)10-13/h3-10H,2,11-12H2,1H3,(H,36,39)/b38-21- |
| InChIKey | QLAZTWVUGDCZFK-GLJXUZQSSA-N |
| XLogP | 7.55 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.34 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|