C31H23Cl2F4N3O4 — CID 123721023
4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[2-[(3-methoxyphenyl)methoxyimino]ethyl]naphthalene-1-carboxamide (PubChem CID 123721023) has the molecular formula C31H23Cl2F4N3O4 and a molecular weight of 648.44 g/mol. Its IUPAC name is 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[2-[(3-methoxyphenyl)methoxyimino]ethyl]naphthalene-1-carboxamide.
| Compound Name | 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[2-[(3-methoxyphenyl)methoxyimino]ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 123721023 |
| Molecular Formula | C31H23Cl2F4N3O4 |
| Molecular Weight | 648.44 g/mol |
| Exact Mass | 647.10 |
| IUPAC Name | 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[2-[(3-methoxyphenyl)methoxyimino]ethyl]naphthalene-1-carboxamide |
| SMILES | COc1cccc(CON=CCNC(=O)c2ccc(C3=NOC(c4cc(Cl)c(F)c(Cl)c4)(C(F)(F)F)C3)c3ccccc23)c1 |
| InChI | InChI=1S/C31H23Cl2F4N3O4/c1-42-20-6-4-5-18(13-20)17-43-39-12-11-38-29(41)24-10-9-23(21-7-2-3-8-22(21)24)27-16-30(44-40-27,31(35,36)37)19-14-25(32)28(34)26(33)15-19/h2-10,12-15H,11,16-17H2,1H3,(H,38,41) |
| InChIKey | YWJOFEPWBLTIJH-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.44 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|