C25H14Cl2F10N2O2 — CID 25255160
N-[[4-[5-[3,5-dichloro-4-(difluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalen-1-yl]methyl]-2,2,3,3,3-pentafluoropropanamide (PubChem CID 25255160) has the molecular formula C25H14Cl2F10N2O2 and a molecular weight of 635.29 g/mol. Its IUPAC name is N-[[4-[5-[3,5-dichloro-4-(difluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalen-1-yl]methyl]-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-[[4-[5-[3,5-dichloro-4-(difluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalen-1-yl]methyl]-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 25255160 |
| Molecular Formula | C25H14Cl2F10N2O2 |
| Molecular Weight | 635.29 g/mol |
| Exact Mass | 634.03 |
| IUPAC Name | N-[[4-[5-[3,5-dichloro-4-(difluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalen-1-yl]methyl]-2,2,3,3,3-pentafluoropropanamide |
| SMILES | O=C(NCc1ccc(C2=NOC(c3cc(Cl)c(C(F)F)c(Cl)c3)(C(F)(F)F)C2)c2ccccc12)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H14Cl2F10N2O2/c26-16-7-12(8-17(27)19(16)20(28)29)22(24(32,33)34)9-18(39-41-22)15-6-5-11(13-3-1-2-4-14(13)15)10-38-21(40)23(30,31)25(35,36)37/h1-8,20H,9-10H2,(H,38,40) |
| InChIKey | ATGRDCQIOBXGDV-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.29 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|