C30H20Cl2F5N3O3 — CID 123545273
4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[2-[(4-fluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide (PubChem CID 123545273) has the molecular formula C30H20Cl2F5N3O3 and a molecular weight of 636.40 g/mol. Its IUPAC name is 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[2-[(4-fluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide.
| Compound Name | 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[2-[(4-fluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 123545273 |
| Molecular Formula | C30H20Cl2F5N3O3 |
| Molecular Weight | 636.40 g/mol |
| Exact Mass | 635.08 |
| IUPAC Name | 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[2-[(4-fluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide |
| SMILES | O=C(NCC=NOCc1ccc(F)cc1)c1ccc(C2=NOC(c3cc(Cl)c(F)c(Cl)c3)(C(F)(F)F)C2)c2ccccc12 |
| InChI | InChI=1S/C30H20Cl2F5N3O3/c31-24-13-18(14-25(32)27(24)34)29(30(35,36)37)15-26(40-43-29)22-9-10-23(21-4-2-1-3-20(21)22)28(41)38-11-12-39-42-16-17-5-7-19(33)8-6-17/h1-10,12-14H,11,15-16H2,(H,38,41) |
| InChIKey | UTRJCAZQQHILDR-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.40 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|