C17H11Cl4F3N2O — CID 58468251
[2-chloro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methanamine (PubChem CID 58468251) has the molecular formula C17H11Cl4F3N2O and a molecular weight of 458.09 g/mol. Its IUPAC name is [2-chloro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methanamine.
| Compound Name | [2-chloro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 58468251 |
| Molecular Formula | C17H11Cl4F3N2O |
| Molecular Weight | 458.09 g/mol |
| Exact Mass | 455.96 |
| IUPAC Name | [2-chloro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methanamine |
| SMILES | NCc1cc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1Cl |
| InChI | InChI=1S/C17H11Cl4F3N2O/c18-11-2-1-8(3-9(11)7-25)14-6-16(27-26-14,17(22,23)24)10-4-12(19)15(21)13(20)5-10/h1-5H,6-7,25H2 |
| InChIKey | NCBVPYFTHLRMLK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.09 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|