C21H18Cl4F3N3O2 — CID 144772469
1-[2-chloro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2-methylhydrazine;cyclopropanecarbaldehyde (PubChem CID 144772469) has the molecular formula C21H18Cl4F3N3O2 and a molecular weight of 543.20 g/mol. Its IUPAC name is 1-[2-chloro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2-methylhydrazine;cyclopropanecarbaldehyde.
| Compound Name | 1-[2-chloro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2-methylhydrazine;cyclopropanecarbaldehyde |
|---|---|
| PubChem CID | 144772469 |
| Molecular Formula | C21H18Cl4F3N3O2 |
| Molecular Weight | 543.20 g/mol |
| Exact Mass | 541.01 |
| IUPAC Name | 1-[2-chloro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2-methylhydrazine;cyclopropanecarbaldehyde |
| SMILES | CNNc1cc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1Cl.O=CC1CC1 |
| InChI | InChI=1S/C17H12Cl4F3N3O.C4H6O/c1-25-26-13-4-8(2-3-10(13)18)14-7-16(28-27-14,17(22,23)24)9-5-11(19)15(21)12(20)6-9;5-3-4-1-2-4/h2-6,25-26H,7H2,1H3;3-4H,1-2H2 |
| InChIKey | NLZZANMYLKVDEJ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.20 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|