C19H15Cl3F4N2O2 — CID 123466186
1-[[2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methylamino]ethanol (PubChem CID 123466186) has the molecular formula C19H15Cl3F4N2O2 and a molecular weight of 485.69 g/mol. Its IUPAC name is 1-[[2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methylamino]ethanol.
| Compound Name | 1-[[2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 123466186 |
| Molecular Formula | C19H15Cl3F4N2O2 |
| Molecular Weight | 485.69 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | 1-[[2-fluoro-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methylamino]ethanol |
| SMILES | CC(O)NCc1cc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1F |
| InChI | InChI=1S/C19H15Cl3F4N2O2/c1-9(29)27-8-11-4-10(2-3-15(11)23)16-7-18(30-28-16,19(24,25)26)12-5-13(20)17(22)14(21)6-12/h2-6,9,27,29H,7-8H2,1H3 |
| InChIKey | KPCBDIILAFFUEM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.69 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|