C19H12BrCl4F3N2O2 — CID 140559928
N-[bromo-[2-chloro-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]acetamide (PubChem CID 140559928) has the molecular formula C19H12BrCl4F3N2O2 and a molecular weight of 579.03 g/mol. Its IUPAC name is N-[bromo-[2-chloro-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]acetamide.
| Compound Name | N-[bromo-[2-chloro-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 140559928 |
| Molecular Formula | C19H12BrCl4F3N2O2 |
| Molecular Weight | 579.03 g/mol |
| Exact Mass | 575.88 |
| IUPAC Name | N-[bromo-[2-chloro-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NC(Br)c1ccc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)cc1Cl |
| InChI | InChI=1S/C19H12BrCl4F3N2O2/c1-8(30)28-17(20)11-3-2-9(4-12(11)21)15-7-18(31-29-15,19(25,26)27)10-5-13(22)16(24)14(23)6-10/h2-6,17H,7H2,1H3,(H,28,30) |
| InChIKey | DGUXXEIXRONMMU-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.03 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|