C24H18Cl3F3N4O3 — CID 56655675
1-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]anilino]-3-(4-methoxyphenyl)urea (PubChem CID 56655675) has the molecular formula C24H18Cl3F3N4O3 and a molecular weight of 573.79 g/mol. Its IUPAC name is 1-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]anilino]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]anilino]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 56655675 |
| Molecular Formula | C24H18Cl3F3N4O3 |
| Molecular Weight | 573.79 g/mol |
| Exact Mass | 572.04 |
| IUPAC Name | 1-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]anilino]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NNc2cc(C3=NOC(c4cc(Cl)cc(Cl)c4)(C(F)(F)F)C3)ccc2Cl)cc1 |
| InChI | InChI=1S/C24H18Cl3F3N4O3/c1-36-18-5-3-17(4-6-18)31-22(35)33-32-20-8-13(2-7-19(20)27)21-12-23(37-34-21,24(28,29)30)14-9-15(25)11-16(26)10-14/h2-11,32H,12H2,1H3,(H2,31,33,35) |
| InChIKey | DHSDWXNBCAXDRB-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.79 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|