C19H13Cl2F3N2O4 — CID 178068354
3-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]anilino]-3-oxopropanoic acid (PubChem CID 178068354) has the molecular formula C19H13Cl2F3N2O4 and a molecular weight of 461.22 g/mol. Its IUPAC name is 3-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]anilino]-3-oxopropanoic acid.
| Compound Name | 3-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 178068354 |
| Molecular Formula | C19H13Cl2F3N2O4 |
| Molecular Weight | 461.22 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 3-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]anilino]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)Nc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C19H13Cl2F3N2O4/c20-12-5-11(6-13(21)7-12)18(19(22,23)24)9-15(26-30-18)10-1-3-14(4-2-10)25-16(27)8-17(28)29/h1-7H,8-9H2,(H,25,27)(H,28,29) |
| InChIKey | SCMGTBBWMDKYKG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.22 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|