C17H12Cl2F3N3O3 — CID 164897860
5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-methoxypyridine-2-carboxamide (PubChem CID 164897860) has the molecular formula C17H12Cl2F3N3O3 and a molecular weight of 434.20 g/mol. Its IUPAC name is 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-methoxypyridine-2-carboxamide.
| Compound Name | 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 164897860 |
| Molecular Formula | C17H12Cl2F3N3O3 |
| Molecular Weight | 434.20 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-methoxypyridine-2-carboxamide |
| SMILES | CONC(=O)c1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cn1 |
| InChI | InChI=1S/C17H12Cl2F3N3O3/c1-27-25-15(26)13-3-2-9(8-23-13)14-7-16(28-24-14,17(20,21)22)10-4-11(18)6-12(19)5-10/h2-6,8H,7H2,1H3,(H,25,26) |
| InChIKey | HQRDOMOGPOPBMS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.20 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|