C19H13Cl3F3NO3 — CID 87498499
[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl 2-chloroacetate (PubChem CID 87498499) has the molecular formula C19H13Cl3F3NO3 and a molecular weight of 466.67 g/mol. Its IUPAC name is [4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl 2-chloroacetate.
| Compound Name | [4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl 2-chloroacetate |
|---|---|
| PubChem CID | 87498499 |
| Molecular Formula | C19H13Cl3F3NO3 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 464.99 |
| IUPAC Name | [4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl 2-chloroacetate |
| SMILES | O=C(CCl)OCc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C19H13Cl3F3NO3/c20-9-17(27)28-10-11-1-3-12(4-2-11)16-8-18(29-26-16,19(23,24)25)13-5-14(21)7-15(22)6-13/h1-7H,8-10H2 |
| InChIKey | APUDTKLYRWVVHP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|