C18H11BrCl2F3NO3 — CID 87529950
2-(bromomethyl)-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoic acid (PubChem CID 87529950) has the molecular formula C18H11BrCl2F3NO3 and a molecular weight of 497.09 g/mol. Its IUPAC name is 2-(bromomethyl)-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoic acid.
| Compound Name | 2-(bromomethyl)-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 87529950 |
| Molecular Formula | C18H11BrCl2F3NO3 |
| Molecular Weight | 497.09 g/mol |
| Exact Mass | 494.93 |
| IUPAC Name | 2-(bromomethyl)-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1CBr |
| InChI | InChI=1S/C18H11BrCl2F3NO3/c19-8-10-3-9(1-2-14(10)16(26)27)15-7-17(28-25-15,18(22,23)24)11-4-12(20)6-13(21)5-11/h1-6H,7-8H2,(H,26,27) |
| InChIKey | YNDAKNMUOAFEGN-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.09 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|