C19H14Cl2F3NO4S — CID 175393496
1-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]cyclopropane-1-sulfonic acid (PubChem CID 175393496) has the molecular formula C19H14Cl2F3NO4S and a molecular weight of 480.29 g/mol. Its IUPAC name is 1-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]cyclopropane-1-sulfonic acid.
| Compound Name | 1-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]cyclopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 175393496 |
| Molecular Formula | C19H14Cl2F3NO4S |
| Molecular Weight | 480.29 g/mol |
| Exact Mass | 479.00 |
| IUPAC Name | 1-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]cyclopropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C1(c2ccc(C3=NOC(c4cc(Cl)cc(Cl)c4)(C(F)(F)F)C3)cc2)CC1 |
| InChI | InChI=1S/C19H14Cl2F3NO4S/c20-14-7-13(8-15(21)9-14)18(19(22,23)24)10-16(25-29-18)11-1-3-12(4-2-11)17(5-6-17)30(26,27)28/h1-4,7-9H,5-6,10H2,(H,26,27,28) |
| InChIKey | QRRVTCJMWAEJGY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.29 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|