C22H13Cl2F4NO4S — CID 175393511
4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-fluoro-3-phenylbenzenesulfonic acid (PubChem CID 175393511) has the molecular formula C22H13Cl2F4NO4S and a molecular weight of 534.31 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-fluoro-3-phenylbenzenesulfonic acid.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-fluoro-3-phenylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175393511 |
| Molecular Formula | C22H13Cl2F4NO4S |
| Molecular Weight | 534.31 g/mol |
| Exact Mass | 532.99 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-fluoro-3-phenylbenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)c(-c2ccccc2)c1F |
| InChI | InChI=1S/C22H13Cl2F4NO4S/c23-14-8-13(9-15(24)10-14)21(22(26,27)28)11-17(29-33-21)16-6-7-18(34(30,31)32)20(25)19(16)12-4-2-1-3-5-12/h1-10H,11H2,(H,30,31,32) |
| InChIKey | KEQSPUZISRHVEB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.31 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|