C17H11BCl2F3NO3 — CID 71573271
5-(3,5-dichlorophenyl)-3-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-(trifluoromethyl)-4H-1,2-oxazole (PubChem CID 71573271) has the molecular formula C17H11BCl2F3NO3 and a molecular weight of 415.99 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-3-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-(trifluoromethyl)-4H-1,2-oxazole.
| Compound Name | 5-(3,5-dichlorophenyl)-3-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-(trifluoromethyl)-4H-1,2-oxazole |
|---|---|
| PubChem CID | 71573271 |
| Molecular Formula | C17H11BCl2F3NO3 |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-3-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-(trifluoromethyl)-4H-1,2-oxazole |
| SMILES | OB1OCc2cc(C3=NOC(c4cc(Cl)cc(Cl)c4)(C(F)(F)F)C3)ccc21 |
| InChI | InChI=1S/C17H11BCl2F3NO3/c19-12-4-11(5-13(20)6-12)16(17(21,22)23)7-15(24-27-16)9-1-2-14-10(3-9)8-26-18(14)25/h1-6,25H,7-8H2 |
| InChIKey | XWZQZAWZHMBUCW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|