C16H12Cl2F3N3O — CID 58533510
[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]hydrazine (PubChem CID 58533510) has the molecular formula C16H12Cl2F3N3O and a molecular weight of 390.19 g/mol. Its IUPAC name is [3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]hydrazine.
| Compound Name | [3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]hydrazine |
|---|---|
| PubChem CID | 58533510 |
| Molecular Formula | C16H12Cl2F3N3O |
| Molecular Weight | 390.19 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | [3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]hydrazine |
| SMILES | NNc1cccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C16H12Cl2F3N3O/c17-11-5-10(6-12(18)7-11)15(16(19,20)21)8-14(24-25-15)9-2-1-3-13(4-9)23-22/h1-7,23H,8,22H2 |
| InChIKey | GMIWDLLPQPRGSP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.19 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|