C16H10Cl3F3N2O3 — CID 88924562
2-methyl-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]furan-3-carboxamide (PubChem CID 88924562) has the molecular formula C16H10Cl3F3N2O3 and a molecular weight of 441.62 g/mol. Its IUPAC name is 2-methyl-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]furan-3-carboxamide.
| Compound Name | 2-methyl-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 88924562 |
| Molecular Formula | C16H10Cl3F3N2O3 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | 2-methyl-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]furan-3-carboxamide |
| SMILES | Cc1oc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)cc1C(N)=O |
| InChI | InChI=1S/C16H10Cl3F3N2O3/c1-6-8(14(23)25)4-12(26-6)11-5-15(27-24-11,16(20,21)22)7-2-9(17)13(19)10(18)3-7/h2-4H,5H2,1H3,(H2,23,25) |
| InChIKey | DXRCGRPLDJRIRB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|