C15H10Cl2F4O3 — CID 170555242
methyl 2-(3,5-dichloro-4-fluorophenyl)-6-methylidene-2-(trifluoromethyl)-3H-pyran-4-carboxylate (PubChem CID 170555242) has the molecular formula C15H10Cl2F4O3 and a molecular weight of 385.14 g/mol. Its IUPAC name is methyl 2-(3,5-dichloro-4-fluorophenyl)-6-methylidene-2-(trifluoromethyl)-3H-pyran-4-carboxylate.
| Compound Name | methyl 2-(3,5-dichloro-4-fluorophenyl)-6-methylidene-2-(trifluoromethyl)-3H-pyran-4-carboxylate |
|---|---|
| PubChem CID | 170555242 |
| Molecular Formula | C15H10Cl2F4O3 |
| Molecular Weight | 385.14 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | methyl 2-(3,5-dichloro-4-fluorophenyl)-6-methylidene-2-(trifluoromethyl)-3H-pyran-4-carboxylate |
| SMILES | C=C1C=C(C(=O)OC)CC(c2cc(Cl)c(F)c(Cl)c2)(C(F)(F)F)O1 |
| InChI | InChI=1S/C15H10Cl2F4O3/c1-7-3-8(13(22)23-2)6-14(24-7,15(19,20)21)9-4-10(16)12(18)11(17)5-9/h3-5H,1,6H2,2H3 |
| InChIKey | GWGHMEJCTDBIGY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.14 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|