C22H15Cl2F4NO3S — CID 146491853
S-methoxy (2E,4E)-5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-5-phenylpenta-2,4-dienethioate (PubChem CID 146491853) has the molecular formula C22H15Cl2F4NO3S and a molecular weight of 520.33 g/mol. Its IUPAC name is S-methoxy (2E,4E)-5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-5-phenylpenta-2,4-dienethioate.
| Compound Name | S-methoxy (2E,4E)-5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-5-phenylpenta-2,4-dienethioate |
|---|---|
| PubChem CID | 146491853 |
| Molecular Formula | C22H15Cl2F4NO3S |
| Molecular Weight | 520.33 g/mol |
| Exact Mass | 519.01 |
| IUPAC Name | S-methoxy (2E,4E)-5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-5-phenylpenta-2,4-dienethioate |
| SMILES | COSC(=O)/C=C/C=C(/C1=NOC(c2cc(Cl)c(F)c(Cl)c2)(C(F)(F)F)C1)c1ccccc1 |
| InChI | InChI=1S/C22H15Cl2F4NO3S/c1-31-33-19(30)9-5-8-15(13-6-3-2-4-7-13)18-12-21(32-29-18,22(26,27)28)14-10-16(23)20(25)17(24)11-14/h2-11H,12H2,1H3/b9-5+,15-8+ |
| InChIKey | QRJFGMDMQKLFFQ-DFQJZRGGSA-N |
| XLogP | 7.13 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.33 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|