C32H24Cl2F4N2O2 — CID 71678990
1-benzhydryl-3-[4-[(5R)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol (PubChem CID 71678990) has the molecular formula C32H24Cl2F4N2O2 and a molecular weight of 615.45 g/mol. Its IUPAC name is 1-benzhydryl-3-[4-[(5R)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol.
| Compound Name | 1-benzhydryl-3-[4-[(5R)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol |
|---|---|
| PubChem CID | 71678990 |
| Molecular Formula | C32H24Cl2F4N2O2 |
| Molecular Weight | 615.45 g/mol |
| Exact Mass | 614.12 |
| IUPAC Name | 1-benzhydryl-3-[4-[(5R)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol |
| SMILES | OC1(c2ccc(C3=NO[C@](c4cc(Cl)c(F)c(Cl)c4)(C(F)(F)F)C3)cc2)CN(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C32H24Cl2F4N2O2/c33-25-15-24(16-26(34)28(25)35)31(32(36,37)38)17-27(39-42-31)20-11-13-23(14-12-20)30(41)18-40(19-30)29(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-16,29,41H,17-19H2/t31-/m1/s1 |
| InChIKey | JIBSIASZRONXMB-WJOKGBTCSA-N |
| XLogP | 8.01 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.45 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|