C32H23BrCl2F4N2O2 — CID 88886086
1-benzhydryl-3-[2-bromo-4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol (PubChem CID 88886086) has the molecular formula C32H23BrCl2F4N2O2 and a molecular weight of 694.35 g/mol. Its IUPAC name is 1-benzhydryl-3-[2-bromo-4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol.
| Compound Name | 1-benzhydryl-3-[2-bromo-4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol |
|---|---|
| PubChem CID | 88886086 |
| Molecular Formula | C32H23BrCl2F4N2O2 |
| Molecular Weight | 694.35 g/mol |
| Exact Mass | 692.03 |
| IUPAC Name | 1-benzhydryl-3-[2-bromo-4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol |
| SMILES | OC1(c2ccc(C3=NOC(c4cc(Cl)c(F)c(Cl)c4)(C(F)(F)F)C3)cc2Br)CN(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C32H23BrCl2F4N2O2/c33-24-13-21(27-16-31(43-40-27,32(37,38)39)22-14-25(34)28(36)26(35)15-22)11-12-23(24)30(42)17-41(18-30)29(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-15,29,42H,16-18H2 |
| InChIKey | SLDDNLRKOQWLIE-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.35 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|