C10H7Cl2F3N2O — CID 147939216
5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-amine (PubChem CID 147939216) has the molecular formula C10H7Cl2F3N2O and a molecular weight of 299.08 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-amine.
| Compound Name | 5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 147939216 |
| Molecular Formula | C10H7Cl2F3N2O |
| Molecular Weight | 299.08 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-amine |
| SMILES | NC1=NOC(c2cc(Cl)cc(Cl)c2)(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H7Cl2F3N2O/c11-6-1-5(2-7(12)3-6)9(10(13,14)15)4-8(16)17-18-9/h1-3H,4H2,(H2,16,17) |
| InChIKey | ILKAWHSBFMQGEN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.08 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |