C22H19Cl4F3N2O3 — CID 87399941
tert-butyl N-chloro-N-[[3-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]carbamate (PubChem CID 87399941) has the molecular formula C22H19Cl4F3N2O3 and a molecular weight of 558.21 g/mol. Its IUPAC name is tert-butyl N-chloro-N-[[3-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-chloro-N-[[3-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 87399941 |
| Molecular Formula | C22H19Cl4F3N2O3 |
| Molecular Weight | 558.21 g/mol |
| Exact Mass | 556.01 |
| IUPAC Name | tert-butyl N-chloro-N-[[3-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cl)Cc1cccc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C22H19Cl4F3N2O3/c1-20(2,3)33-19(32)31(26)11-12-5-4-6-13(7-12)17-10-21(34-30-17,22(27,28)29)14-8-15(23)18(25)16(24)9-14/h4-9H,10-11H2,1-3H3 |
| InChIKey | UHSNZZALPFXWAA-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.21 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|