C21H19BrCl3NO — CID 147122990
3-[3-bromo-4-(3-methylbut-3-enyl)phenyl]-5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazole (PubChem CID 147122990) has the molecular formula C21H19BrCl3NO and a molecular weight of 487.65 g/mol. Its IUPAC name is 3-[3-bromo-4-(3-methylbut-3-enyl)phenyl]-5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazole.
| Compound Name | 3-[3-bromo-4-(3-methylbut-3-enyl)phenyl]-5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazole |
|---|---|
| PubChem CID | 147122990 |
| Molecular Formula | C21H19BrCl3NO |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 484.97 |
| IUPAC Name | 3-[3-bromo-4-(3-methylbut-3-enyl)phenyl]-5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazole |
| SMILES | C=C(C)CCc1ccc(C2=NOC(C)(c3cc(Cl)c(Cl)c(Cl)c3)C2)cc1Br |
| InChI | InChI=1S/C21H19BrCl3NO/c1-12(2)4-5-13-6-7-14(8-16(13)22)19-11-21(3,27-26-19)15-9-17(23)20(25)18(24)10-15/h6-10H,1,4-5,11H2,2-3H3 |
| InChIKey | BOSXEQRXHPHIRW-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|