C21H19Cl3N2O3 — CID 58182802
4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]-N-(oxolan-2-yl)benzamide (PubChem CID 58182802) has the molecular formula C21H19Cl3N2O3 and a molecular weight of 453.75 g/mol. Its IUPAC name is 4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]-N-(oxolan-2-yl)benzamide.
| Compound Name | 4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]-N-(oxolan-2-yl)benzamide |
|---|---|
| PubChem CID | 58182802 |
| Molecular Formula | C21H19Cl3N2O3 |
| Molecular Weight | 453.75 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 4-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]-N-(oxolan-2-yl)benzamide |
| SMILES | CC1(c2cc(Cl)c(Cl)c(Cl)c2)CC(c2ccc(C(=O)NC3CCCO3)cc2)=NO1 |
| InChI | InChI=1S/C21H19Cl3N2O3/c1-21(14-9-15(22)19(24)16(23)10-14)11-17(26-29-21)12-4-6-13(7-5-12)20(27)25-18-3-2-8-28-18/h4-7,9-10,18H,2-3,8,11H2,1H3,(H,25,27) |
| InChIKey | CJLXAFJXPZAUFE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.75 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|