C18H18ClN3O3 — CID 59355672
methyl N-[2-chloro-5-(5-methyl-5-phenyl-4H-1,2-oxazol-3-yl)anilino]carbamate (PubChem CID 59355672) has the molecular formula C18H18ClN3O3 and a molecular weight of 359.81 g/mol. Its IUPAC name is methyl N-[2-chloro-5-(5-methyl-5-phenyl-4H-1,2-oxazol-3-yl)anilino]carbamate.
| Compound Name | methyl N-[2-chloro-5-(5-methyl-5-phenyl-4H-1,2-oxazol-3-yl)anilino]carbamate |
|---|---|
| PubChem CID | 59355672 |
| Molecular Formula | C18H18ClN3O3 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | methyl N-[2-chloro-5-(5-methyl-5-phenyl-4H-1,2-oxazol-3-yl)anilino]carbamate |
| SMILES | COC(=O)NNc1cc(C2=NOC(C)(c3ccccc3)C2)ccc1Cl |
| InChI | InChI=1S/C18H18ClN3O3/c1-18(13-6-4-3-5-7-13)11-16(22-25-18)12-8-9-14(19)15(10-12)20-21-17(23)24-2/h3-10,20H,11H2,1-2H3,(H,21,23) |
| InChIKey | SSMDAADWNHTCNN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|