C22H20BrCl2NO2S — CID 158772674
1-[4-[5-(4-bromo-3,5-dichlorophenyl)-5-methyl-4H-1,2-oxazol-3-yl]-2-methylphenyl]-2-(thietan-3-yl)ethanone (PubChem CID 158772674) has the molecular formula C22H20BrCl2NO2S and a molecular weight of 513.28 g/mol. Its IUPAC name is 1-[4-[5-(4-bromo-3,5-dichlorophenyl)-5-methyl-4H-1,2-oxazol-3-yl]-2-methylphenyl]-2-(thietan-3-yl)ethanone.
| Compound Name | 1-[4-[5-(4-bromo-3,5-dichlorophenyl)-5-methyl-4H-1,2-oxazol-3-yl]-2-methylphenyl]-2-(thietan-3-yl)ethanone |
|---|---|
| PubChem CID | 158772674 |
| Molecular Formula | C22H20BrCl2NO2S |
| Molecular Weight | 513.28 g/mol |
| Exact Mass | 510.98 |
| IUPAC Name | 1-[4-[5-(4-bromo-3,5-dichlorophenyl)-5-methyl-4H-1,2-oxazol-3-yl]-2-methylphenyl]-2-(thietan-3-yl)ethanone |
| SMILES | Cc1cc(C2=NOC(C)(c3cc(Cl)c(Br)c(Cl)c3)C2)ccc1C(=O)CC1CSC1 |
| InChI | InChI=1S/C22H20BrCl2NO2S/c1-12-5-14(3-4-16(12)20(27)6-13-10-29-11-13)19-9-22(2,28-26-19)15-7-17(24)21(23)18(25)8-15/h3-5,7-8,13H,6,9-11H2,1-2H3 |
| InChIKey | IQBLNAFWAYTFCF-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.28 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|