About 5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole
5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole (PubChem CID 91719392) has the molecular formula C16H24N2O
and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole |
| PubChem CID | 91719392 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole |
| SMILES | CCCCCCCCC1CC(c2ccncc2)=NO1 |
| InChI | InChI=1S/C16H24N2O/c1-2-3-4-5-6-7-8-15-13-16(18-19-15)14-9-11-17-12-10-14/h9-12,15H,2-8,13H2,1H3 |
| InChIKey | OFXXPAXECBWWGJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole?
The IUPAC name of 5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole (CID 91719392) is 5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole is CCCCCCCCC1CC(c2ccncc2)=NO1.
What is the InChIKey of 5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole?
The InChIKey is OFXXPAXECBWWGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O/c1-2-3-4-5-6-7-8-15-13-16(18-19-15)14-9-11-17-12-10-14/h9-12,15H,2-8,13H2,1H3.
What are the key properties of 5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole?
5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole has a molecular weight of 260.38 g/mol, XLogP of 4.33, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-octyl-3-pyridin-4-yl-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 91719392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).