C12H21NO3 — CID 14616471
3-(5-hexyl-4,5-dihydro-1,2-oxazol-3-yl)propanoic acid (PubChem CID 14616471) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 3-(5-hexyl-4,5-dihydro-1,2-oxazol-3-yl)propanoic acid.
| Compound Name | 3-(5-hexyl-4,5-dihydro-1,2-oxazol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 14616471 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 3-(5-hexyl-4,5-dihydro-1,2-oxazol-3-yl)propanoic acid |
| SMILES | CCCCCCC1CC(CCC(=O)O)=NO1 |
| InChI | InChI=1S/C12H21NO3/c1-2-3-4-5-6-11-9-10(13-16-11)7-8-12(14)15/h11H,2-9H2,1H3,(H,14,15) |
| InChIKey | MGSVMTVJBSXVQL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|