C20H34N2O6 — CID 142461307
4-[3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropoxy]-4-oxobutanoic acid (PubChem CID 142461307) has the molecular formula C20H34N2O6 and a molecular weight of 398.50 g/mol. Its IUPAC name is 4-[3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropoxy]-4-oxobutanoic acid.
| Compound Name | 4-[3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 142461307 |
| Molecular Formula | C20H34N2O6 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 4-[3-(4,6-dipentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropoxy]-4-oxobutanoic acid |
| SMILES | CCCCCC1=NN(C(=O)CCOC(=O)CCC(=O)O)OC(CCCCC)C1 |
| InChI | InChI=1S/C20H34N2O6/c1-3-5-7-9-16-15-17(10-8-6-4-2)28-22(21-16)18(23)13-14-27-20(26)12-11-19(24)25/h17H,3-15H2,1-2H3,(H,24,25) |
| InChIKey | JBEPYVVJOHVLNQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|