C12H21NO2 — CID 102418661
1-(5-heptyl-4,5-dihydro-1,2-oxazol-3-yl)ethanone (PubChem CID 102418661) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 1-(5-heptyl-4,5-dihydro-1,2-oxazol-3-yl)ethanone.
| Compound Name | 1-(5-heptyl-4,5-dihydro-1,2-oxazol-3-yl)ethanone |
|---|---|
| PubChem CID | 102418661 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 1-(5-heptyl-4,5-dihydro-1,2-oxazol-3-yl)ethanone |
| SMILES | CCCCCCCC1CC(C(C)=O)=NO1 |
| InChI | InChI=1S/C12H21NO2/c1-3-4-5-6-7-8-11-9-12(10(2)14)13-15-11/h11H,3-9H2,1-2H3 |
| InChIKey | HFXUTZBCTMWBMP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|