About 5-ethyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid
5-ethyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid (PubChem CID 105428413) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is 5-ethyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
Analyze 5-ethyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-ethyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid (CID 105428413) is 5-ethyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-ethyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-ethyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid is CCC1CC(C(=O)O)=NO1.
What is the InChIKey of 5-ethyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid?
The InChIKey is HEEQOHBICUZLON-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-2-4-3-5(6(8)9)7-10-4/h4H,2-3H2,1H3,(H,8,9).
What are the key properties of 5-ethyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid?
5-ethyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid has a molecular weight of 143.14 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 105428413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).