About 5-cyclopentyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid
5-cyclopentyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid (PubChem CID 105440485) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-cyclopentyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
Analyze 5-cyclopentyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-cyclopentyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid (CID 105440485) is 5-cyclopentyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-cyclopentyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-cyclopentyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid is O=C(O)C1=NOC(C2CCCC2)C1.
What is the InChIKey of 5-cyclopentyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid?
The InChIKey is VSCNHWROTYIWCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c11-9(12)7-5-8(13-10-7)6-3-1-2-4-6/h6,8H,1-5H2,(H,11,12).
What are the key properties of 5-cyclopentyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid?
5-cyclopentyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid has a molecular weight of 183.21 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 105440485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).