C9H15NO — CID 134260939
5-cyclopentyl-3-methyl-4,5-dihydro-1,2-oxazole (PubChem CID 134260939) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 5-cyclopentyl-3-methyl-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-cyclopentyl-3-methyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 134260939 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 5-cyclopentyl-3-methyl-4,5-dihydro-1,2-oxazole |
| SMILES | CC1=NOC(C2CCCC2)C1 |
| InChI | InChI=1S/C9H15NO/c1-7-6-9(11-10-7)8-4-2-3-5-8/h8-9H,2-6H2,1H3 |
| InChIKey | BIQKRLXGIULEIW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |