C8H19NO2 — CID 143101190
ethane;3-methyl-4,5-dihydro-1,2-oxazol-5-ol (PubChem CID 143101190) has the molecular formula C8H19NO2 and a molecular weight of 161.24 g/mol. Its IUPAC name is ethane;3-methyl-4,5-dihydro-1,2-oxazol-5-ol.
| Compound Name | ethane;3-methyl-4,5-dihydro-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 143101190 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.24 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | ethane;3-methyl-4,5-dihydro-1,2-oxazol-5-ol |
| SMILES | CC.CC.CC1=NOC(O)C1 |
| InChI | InChI=1S/C4H7NO2.2C2H6/c1-3-2-4(6)7-5-3;2*1-2/h4,6H,2H2,1H3;2*1-2H3 |
| InChIKey | DVDPVJLMLRHYOZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |