C10H11NO2 — CID 143618145
4-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]phenol (PubChem CID 143618145) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 4-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]phenol.
| Compound Name | 4-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]phenol |
|---|---|
| PubChem CID | 143618145 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 4-[(5R)-3-methyl-4,5-dihydro-1,2-oxazol-5-yl]phenol |
| SMILES | CC1=NO[C@@H](c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C10H11NO2/c1-7-6-10(13-11-7)8-2-4-9(12)5-3-8/h2-5,10,12H,6H2,1H3/t10-/m1/s1 |
| InChIKey | MPQRJYYREWSEAM-SNVBAGLBSA-N |
| XLogP | 2.23 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |