C17H18N2O2 — CID 88979546
4-[(5R)-3-(N-ethylanilino)-4,5-dihydro-1,2-oxazol-5-yl]phenol (PubChem CID 88979546) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-[(5R)-3-(N-ethylanilino)-4,5-dihydro-1,2-oxazol-5-yl]phenol.
| Compound Name | 4-[(5R)-3-(N-ethylanilino)-4,5-dihydro-1,2-oxazol-5-yl]phenol |
|---|---|
| PubChem CID | 88979546 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-[(5R)-3-(N-ethylanilino)-4,5-dihydro-1,2-oxazol-5-yl]phenol |
| SMILES | CCN(C1=NO[C@@H](c2ccc(O)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O2/c1-2-19(14-6-4-3-5-7-14)17-12-16(21-18-17)13-8-10-15(20)11-9-13/h3-11,16,20H,2,12H2,1H3/t16-/m1/s1 |
| InChIKey | FNIUBQJCDORIGZ-MRXNPFEDSA-N |
| XLogP | 3.69 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |