C22H19N3O2 — CID 95062084
(5S)-N',N',5-triphenyl-4,5-dihydro-1,2-oxazole-3-carbohydrazide (PubChem CID 95062084) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is (5S)-N',N',5-triphenyl-4,5-dihydro-1,2-oxazole-3-carbohydrazide.
| Compound Name | (5S)-N',N',5-triphenyl-4,5-dihydro-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 95062084 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (5S)-N',N',5-triphenyl-4,5-dihydro-1,2-oxazole-3-carbohydrazide |
| SMILES | O=C(NN(c1ccccc1)c1ccccc1)C1=NO[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C22H19N3O2/c26-22(20-16-21(27-24-20)17-10-4-1-5-11-17)23-25(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,21H,16H2,(H,23,26)/t21-/m0/s1 |
| InChIKey | UZIYNLCNEDTXOZ-NRFANRHFSA-N |
| XLogP | 4.37 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|