C15H18N2O4 — CID 94463007
methyl 4-[[(5R)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate (PubChem CID 94463007) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is methyl 4-[[(5R)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[(5R)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 94463007 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl 4-[[(5R)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)C1=NO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C15H18N2O4/c1-20-14(18)8-5-9-16-15(19)12-10-13(21-17-12)11-6-3-2-4-7-11/h2-4,6-7,13H,5,8-10H2,1H3,(H,16,19)/t13-/m1/s1 |
| InChIKey | QWXIHTJIYKHABN-CYBMUJFWSA-N |
| XLogP | 1.57 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|