C11H10BrNO2 — CID 87557465
2-bromo-1-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)ethanone (PubChem CID 87557465) has the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. Its IUPAC name is 2-bromo-1-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)ethanone.
| Compound Name | 2-bromo-1-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)ethanone |
|---|---|
| PubChem CID | 87557465 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 2-bromo-1-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)ethanone |
| SMILES | O=C(CBr)C1=NOC(c2ccccc2)C1 |
| InChI | InChI=1S/C11H10BrNO2/c12-7-10(14)9-6-11(15-13-9)8-4-2-1-3-5-8/h1-5,11H,6-7H2 |
| InChIKey | CJJXFVIYQZJUEX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|