C13H17N3O4S — CID 94569889
(5R)-N-[2-(methanesulfonamido)ethyl]-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 94569889) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is (5R)-N-[2-(methanesulfonamido)ethyl]-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | (5R)-N-[2-(methanesulfonamido)ethyl]-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 94569889 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (5R)-N-[2-(methanesulfonamido)ethyl]-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | CS(=O)(=O)NCCNC(=O)C1=NO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C13H17N3O4S/c1-21(18,19)15-8-7-14-13(17)11-9-12(20-16-11)10-5-3-2-4-6-10/h2-6,12,15H,7-9H2,1H3,(H,14,17)/t12-/m1/s1 |
| InChIKey | VTRZJEBQMWHVSK-GFCCVEGCSA-N |
| XLogP | 0.17 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|