C19H19N3O4 — CID 55863429
N'-(4-ethoxybenzoyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carbohydrazide (PubChem CID 55863429) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is N'-(4-ethoxybenzoyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carbohydrazide.
| Compound Name | N'-(4-ethoxybenzoyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 55863429 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N'-(4-ethoxybenzoyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carbohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)C2=NOC(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C19H19N3O4/c1-2-25-15-10-8-14(9-11-15)18(23)20-21-19(24)16-12-17(26-22-16)13-6-4-3-5-7-13/h3-11,17H,2,12H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | YHCYZKMTSNMRTG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|