C17H19N5O2 — CID 95309406
(5S)-N-[2-[(6-methylpyridazin-3-yl)amino]ethyl]-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 95309406) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is (5S)-N-[2-[(6-methylpyridazin-3-yl)amino]ethyl]-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | (5S)-N-[2-[(6-methylpyridazin-3-yl)amino]ethyl]-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 95309406 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (5S)-N-[2-[(6-methylpyridazin-3-yl)amino]ethyl]-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | Cc1ccc(NCCNC(=O)C2=NO[C@H](c3ccccc3)C2)nn1 |
| InChI | InChI=1S/C17H19N5O2/c1-12-7-8-16(21-20-12)18-9-10-19-17(23)14-11-15(24-22-14)13-5-3-2-4-6-13/h2-8,15H,9-11H2,1H3,(H,18,21)(H,19,23)/t15-/m0/s1 |
| InChIKey | URIQCYQYKQRBOC-HNNXBMFYSA-N |
| XLogP | 1.83 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|