About (5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide
(5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 124508168) has the molecular formula C15H12ClN3O2
and a molecular weight of 301.73 g/mol. Its IUPAC name is (5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | (5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide |
| PubChem CID | 124508168 |
| Molecular Formula | C15H12ClN3O2 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | (5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)n1)C1=NO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C15H12ClN3O2/c16-13-7-4-8-14(17-13)18-15(20)11-9-12(21-19-11)10-5-2-1-3-6-10/h1-8,12H,9H2,(H,17,18,20)/t12-/m1/s1 |
| InChIKey | MBTHIRMAGYBQMV-GFCCVEGCSA-N |
| XLogP | 3.19 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide?
The IUPAC name of (5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide (CID 124508168) is (5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide.
What is the SMILES notation for (5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide?
The canonical SMILES for (5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide is O=C(Nc1cccc(Cl)n1)C1=NO[C@@H](c2ccccc2)C1.
What is the InChIKey of (5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide?
The InChIKey is MBTHIRMAGYBQMV-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H12ClN3O2/c16-13-7-4-8-14(17-13)18-15(20)11-9-12(21-19-11)10-5-2-1-3-6-10/h1-8,12H,9H2,(H,17,18,20)/t12-/m1/s1.
What are the key properties of (5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide?
(5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide has a molecular weight of 301.73 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-N-(6-chloro-2-pyridinyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 124508168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).